C20H20N2O5S — CID 7492892
[2-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)amino]-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 7492892) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)amino]-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)amino]-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 7492892 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)amino]-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)COC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O5S/c1-3-12-9-14(19(24)26-4-2)18(28-12)22-17(23)11-27-20(25)15-10-21-16-8-6-5-7-13(15)16/h5-10,21H,3-4,11H2,1-2H3,(H,22,23) |
| InChIKey | NHIXKMCHUFTWOF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |