About ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride
ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride (PubChem CID 141063038) has the molecular formula C11H14ClNO3
and a molecular weight of 243.69 g/mol. Its IUPAC name is ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride |
| PubChem CID | 141063038 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride |
| SMILES | CCOC(=O)c1c[nH]c2ccccc12.Cl.O |
| InChI | InChI=1S/C11H11NO2.ClH.H2O/c1-2-14-11(13)9-7-12-10-6-4-3-5-8(9)10;;/h3-7,12H,2H2,1H3;1H;1H2 |
| InChIKey | JQQJIHLFMYTPBT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
The IUPAC name of ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride (CID 141063038) is ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride.
What is the SMILES notation for ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
The canonical SMILES for ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride is CCOC(=O)c1c[nH]c2ccccc12.Cl.O.
What is the InChIKey of ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
The InChIKey is JQQJIHLFMYTPBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.ClH.H2O/c1-2-14-11(13)9-7-12-10-6-4-3-5-8(9)10;;/h3-7,12H,2H2,1H3;1H;1H2.
What are the key properties of ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride has a molecular weight of 243.69 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-indole-3-carboxylate;hydrate;hydrochloride is sourced from PubChem (CID 141063038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).