C18H12N2O4 — CID 7517850
(1,3-dioxoisoindol-2-yl)methyl 1H-indole-3-carboxylate (PubChem CID 7517850) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 1H-indole-3-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 7517850 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H12N2O4/c21-16-12-6-1-2-7-13(12)17(22)20(16)10-24-18(23)14-9-19-15-8-4-3-5-11(14)15/h1-9,19H,10H2 |
| InChIKey | JTAVOAWHTVPKAL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|