About (2-fluorophenyl)methyl 1H-indole-3-carboxylate
(2-fluorophenyl)methyl 1H-indole-3-carboxylate (PubChem CID 7492710) has the molecular formula C16H12FNO2
and a molecular weight of 269.27 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 1H-indole-3-carboxylate |
| PubChem CID | 7492710 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2-fluorophenyl)methyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCc1ccccc1F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H12FNO2/c17-14-7-3-1-5-11(14)10-20-16(19)13-9-18-15-8-4-2-6-12(13)15/h1-9,18H,10H2 |
| InChIKey | XIXWPGDYIRBHLG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-fluorophenyl)methyl 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 1H-indole-3-carboxylate?
The IUPAC name of (2-fluorophenyl)methyl 1H-indole-3-carboxylate (CID 7492710) is (2-fluorophenyl)methyl 1H-indole-3-carboxylate.
What is the SMILES notation for (2-fluorophenyl)methyl 1H-indole-3-carboxylate?
The canonical SMILES for (2-fluorophenyl)methyl 1H-indole-3-carboxylate is O=C(OCc1ccccc1F)c1c[nH]c2ccccc12.
What is the InChIKey of (2-fluorophenyl)methyl 1H-indole-3-carboxylate?
The InChIKey is XIXWPGDYIRBHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO2/c17-14-7-3-1-5-11(14)10-20-16(19)13-9-18-15-8-4-2-6-12(13)15/h1-9,18H,10H2.
What are the key properties of (2-fluorophenyl)methyl 1H-indole-3-carboxylate?
(2-fluorophenyl)methyl 1H-indole-3-carboxylate has a molecular weight of 269.27 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 1H-indole-3-carboxylate is sourced from PubChem (CID 7492710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).