C17H10ClF2NO3 — CID 2453233
[2-(1H-indol-3-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2453233) has the molecular formula C17H10ClF2NO3 and a molecular weight of 349.72 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2453233 |
| Molecular Formula | C17H10ClF2NO3 |
| Molecular Weight | 349.72 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(OCC(=O)c1c[nH]c2ccccc12)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H10ClF2NO3/c18-12-6-14(20)13(19)5-10(12)17(23)24-8-16(22)11-7-21-15-4-2-1-3-9(11)15/h1-7,21H,8H2 |
| InChIKey | VGLYVTNDCZVJGR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|