C17H11F2NO3 — CID 2689663
[2-(1H-indol-3-yl)-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 2689663) has the molecular formula C17H11F2NO3 and a molecular weight of 315.28 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2689663 |
| Molecular Formula | C17H11F2NO3 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | O=C(OCC(=O)c1c[nH]c2ccccc12)c1c(F)cccc1F |
| InChI | InChI=1S/C17H11F2NO3/c18-12-5-3-6-13(19)16(12)17(22)23-9-15(21)11-8-20-14-7-2-1-4-10(11)14/h1-8,20H,9H2 |
| InChIKey | UXSLZHQFJPNWKH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |