C21H15NO5 — CID 3255141
[2-(1H-indol-3-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 3255141) has the molecular formula C21H15NO5 and a molecular weight of 361.35 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 3255141 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCC(=O)c1c[nH]c2ccccc12)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C21H15NO5/c23-18-9-15(20(25)14-7-2-1-6-13(14)18)21(26)27-11-19(24)16-10-22-17-8-4-3-5-12(16)17/h1-10,22-23,25H,11H2 |
| InChIKey | PPLHEOQHLJSEOF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|