C18H17NO4 — CID 8644175
(2,5-dimethoxyphenyl)methyl 1H-indole-3-carboxylate (PubChem CID 8644175) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 1H-indole-3-carboxylate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8644175 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 1H-indole-3-carboxylate |
| SMILES | COc1ccc(OC)c(COC(=O)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C18H17NO4/c1-21-13-7-8-17(22-2)12(9-13)11-23-18(20)15-10-19-16-6-4-3-5-14(15)16/h3-10,19H,11H2,1-2H3 |
| InChIKey | KSZNHPRSUDITFX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |