(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate

C15H16O5 — CID 78815298

IUPAC(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate
SMILESCOc1ccc(OC)c(COC(=O)c2ccoc2C)c1
InChIInChI=1S/C15H16O5/c1-10-13(6-7-19-10)15(16)20-9-11-8-12(17-2)4-5-14(11)18-3/h4-8H,9H2,1-3H3
InChIKeyYHCJELOUXSMDAJ-UHFFFAOYSA-N
MW276.29 g/mol
LogP2.96
Rot. Bonds5

About (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate

(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate (PubChem CID 78815298) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate.

Molecular Properties

Compound Name(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate
PubChem CID78815298
Molecular FormulaC15H16O5
Molecular Weight276.29 g/mol
Exact Mass276.10
IUPAC Name(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate
SMILESCOc1ccc(OC)c(COC(=O)c2ccoc2C)c1
InChIInChI=1S/C15H16O5/c1-10-13(6-7-19-10)15(16)20-9-11-8-12(17-2)4-5-14(11)18-3/h4-8H,9H2,1-3H3
InChIKeyYHCJELOUXSMDAJ-UHFFFAOYSA-N
XLogP2.96
TPSA57.90 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 52.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate?
The IUPAC name of (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate (CID 78815298) is (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate.
What is the SMILES notation for (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate?
The canonical SMILES for (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate is COc1ccc(OC)c(COC(=O)c2ccoc2C)c1.
What is the InChIKey of (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate?
The InChIKey is YHCJELOUXSMDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-10-13(6-7-19-10)15(16)20-9-11-8-12(17-2)4-5-14(11)18-3/h4-8H,9H2,1-3H3.
What are the key properties of (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate?
(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate has a molecular weight of 276.29 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate is sourced from PubChem (CID 78815298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).