C15H16O5 — CID 78815298
(2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate (PubChem CID 78815298) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 78815298 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 2-methylfuran-3-carboxylate |
| SMILES | COc1ccc(OC)c(COC(=O)c2ccoc2C)c1 |
| InChI | InChI=1S/C15H16O5/c1-10-13(6-7-19-10)15(16)20-9-11-8-12(17-2)4-5-14(11)18-3/h4-8H,9H2,1-3H3 |
| InChIKey | YHCJELOUXSMDAJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |