C14H16N2O6S — CID 8615856
N'-(2,5-dimethoxyphenyl)sulfonyl-2-methylfuran-3-carbohydrazide (PubChem CID 8615856) has the molecular formula C14H16N2O6S and a molecular weight of 340.36 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)sulfonyl-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethoxyphenyl)sulfonyl-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 8615856 |
| Molecular Formula | C14H16N2O6S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)sulfonyl-2-methylfuran-3-carbohydrazide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NNC(=O)c2ccoc2C)c1 |
| InChI | InChI=1S/C14H16N2O6S/c1-9-11(6-7-22-9)14(17)15-16-23(18,19)13-8-10(20-2)4-5-12(13)21-3/h4-8,16H,1-3H3,(H,15,17) |
| InChIKey | HFFBFKMHWGJRRA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|