C13H14BrN3O5S — CID 8823855
4-bromo-N'-(2,5-dimethoxyphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide (PubChem CID 8823855) has the molecular formula C13H14BrN3O5S and a molecular weight of 404.24 g/mol. Its IUPAC name is 4-bromo-N'-(2,5-dimethoxyphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(2,5-dimethoxyphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 8823855 |
| Molecular Formula | C13H14BrN3O5S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 4-bromo-N'-(2,5-dimethoxyphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NNC(=O)c2cc(Br)c[nH]2)c1 |
| InChI | InChI=1S/C13H14BrN3O5S/c1-21-9-3-4-11(22-2)12(6-9)23(19,20)17-16-13(18)10-5-8(14)7-15-10/h3-7,15,17H,1-2H3,(H,16,18) |
| InChIKey | YEZOOKLZUYJOSV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|