C13H14BrN3O4S — CID 8823856
4-bromo-N'-(2-methoxy-5-methylphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide (PubChem CID 8823856) has the molecular formula C13H14BrN3O4S and a molecular weight of 388.24 g/mol. Its IUPAC name is 4-bromo-N'-(2-methoxy-5-methylphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(2-methoxy-5-methylphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 8823856 |
| Molecular Formula | C13H14BrN3O4S |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 4-bromo-N'-(2-methoxy-5-methylphenyl)sulfonyl-1H-pyrrole-2-carbohydrazide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C13H14BrN3O4S/c1-8-3-4-11(21-2)12(5-8)22(19,20)17-16-13(18)10-6-9(14)7-15-10/h3-7,15,17H,1-2H3,(H,16,18) |
| InChIKey | RMQKDXPGNIZCSM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|