C15H16BrN3O4 — CID 31597699
4-bromo-N'-[2-(2-methoxy-4-methylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31597699) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is 4-bromo-N'-[2-(2-methoxy-4-methylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[2-(2-methoxy-4-methylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31597699 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 4-bromo-N'-[2-(2-methoxy-4-methylphenoxy)acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | COc1cc(C)ccc1OCC(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H16BrN3O4/c1-9-3-4-12(13(5-9)22-2)23-8-14(20)18-19-15(21)11-6-10(16)7-17-11/h3-7,17H,8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | CFHPOMVFLLTWNF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|