C14H15BrN2O3 — CID 17459532
4-bromo-N-(4-ethoxy-3-methoxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 17459532) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 4-bromo-N-(4-ethoxy-3-methoxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(4-ethoxy-3-methoxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 17459532 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-bromo-N-(4-ethoxy-3-methoxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(Br)c[nH]2)cc1OC |
| InChI | InChI=1S/C14H15BrN2O3/c1-3-20-12-5-4-10(7-13(12)19-2)17-14(18)11-6-9(15)8-16-11/h4-8,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | NYIAVVSBMLTJRH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |