C12H10BrClN2O2 — CID 107271771
4-bromo-N-(4-chloro-3-methoxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 107271771) has the molecular formula C12H10BrClN2O2 and a molecular weight of 329.58 g/mol. Its IUPAC name is 4-bromo-N-(4-chloro-3-methoxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(4-chloro-3-methoxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107271771 |
| Molecular Formula | C12H10BrClN2O2 |
| Molecular Weight | 329.58 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 4-bromo-N-(4-chloro-3-methoxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(Br)c[nH]2)ccc1Cl |
| InChI | InChI=1S/C12H10BrClN2O2/c1-18-11-5-8(2-3-9(11)14)16-12(17)10-4-7(13)6-15-10/h2-6,15H,1H3,(H,16,17) |
| InChIKey | AJANVZUFNBSHCC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |