C10H8BrN3O — CID 18109255
4-bromo-N-pyridin-4-yl-1H-pyrrole-2-carboxamide (PubChem CID 18109255) has the molecular formula C10H8BrN3O and a molecular weight of 266.10 g/mol. Its IUPAC name is 4-bromo-N-pyridin-4-yl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-pyridin-4-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18109255 |
| Molecular Formula | C10H8BrN3O |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 4-bromo-N-pyridin-4-yl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H8BrN3O/c11-7-5-9(13-6-7)10(15)14-8-1-3-12-4-2-8/h1-6,13H,(H,12,14,15) |
| InChIKey | XYTXEKOKZCAEQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |