C12H8Br2N2O3 — CID 62072760
5-bromo-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]benzoic acid (PubChem CID 62072760) has the molecular formula C12H8Br2N2O3 and a molecular weight of 388.02 g/mol. Its IUPAC name is 5-bromo-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]benzoic acid.
| Compound Name | 5-bromo-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62072760 |
| Molecular Formula | C12H8Br2N2O3 |
| Molecular Weight | 388.02 g/mol |
| Exact Mass | 385.89 |
| IUPAC Name | 5-bromo-2-[(4-bromo-1H-pyrrole-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccc(Br)cc1C(=O)O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C12H8Br2N2O3/c13-6-1-2-9(8(3-6)12(18)19)16-11(17)10-4-7(14)5-15-10/h1-5,15H,(H,16,17)(H,18,19) |
| InChIKey | XSEAZWCZAZQDIB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.02 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |