C12H11BrN2O2 — CID 18109016
4-bromo-N-(2-hydroxy-4-methylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 18109016) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-bromo-N-(2-hydroxy-4-methylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-hydroxy-4-methylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18109016 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 4-bromo-N-(2-hydroxy-4-methylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Br)c[nH]2)c(O)c1 |
| InChI | InChI=1S/C12H11BrN2O2/c1-7-2-3-9(11(16)4-7)15-12(17)10-5-8(13)6-14-10/h2-6,14,16H,1H3,(H,15,17) |
| InChIKey | FJPMIPJJWWYWNG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|