C11H6BrCl3N2O — CID 43410594
4-bromo-N-(2,4,5-trichlorophenyl)-1H-pyrrole-2-carboxamide (PubChem CID 43410594) has the molecular formula C11H6BrCl3N2O and a molecular weight of 368.45 g/mol. Its IUPAC name is 4-bromo-N-(2,4,5-trichlorophenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2,4,5-trichlorophenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43410594 |
| Molecular Formula | C11H6BrCl3N2O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 365.87 |
| IUPAC Name | 4-bromo-N-(2,4,5-trichlorophenyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C11H6BrCl3N2O/c12-5-1-10(16-4-5)11(18)17-9-3-7(14)6(13)2-8(9)15/h1-4,16H,(H,17,18) |
| InChIKey | RIOMAACKFWRPNG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|