C13H11Br2ClN2O2 — CID 60710210
4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 60710210) has the molecular formula C13H11Br2ClN2O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60710210 |
| Molecular Formula | C13H11Br2ClN2O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 419.89 |
| IUPAC Name | 4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | CCOc1c(Br)cc(Cl)cc1NC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C13H11Br2ClN2O2/c1-2-20-12-9(15)4-8(16)5-10(12)18-13(19)11-3-7(14)6-17-11/h3-6,17H,2H2,1H3,(H,18,19) |
| InChIKey | JINSFBULYBVBED-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |