C15H11Br2ClN2O4 — CID 26159725
4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-3-nitrobenzamide (PubChem CID 26159725) has the molecular formula C15H11Br2ClN2O4 and a molecular weight of 478.52 g/mol. Its IUPAC name is 4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-3-nitrobenzamide.
| Compound Name | 4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 26159725 |
| Molecular Formula | C15H11Br2ClN2O4 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 475.88 |
| IUPAC Name | 4-bromo-N-(3-bromo-5-chloro-2-ethoxyphenyl)-3-nitrobenzamide |
| SMILES | CCOc1c(Br)cc(Cl)cc1NC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11Br2ClN2O4/c1-2-24-14-11(17)6-9(18)7-12(14)19-15(21)8-3-4-10(16)13(5-8)20(22)23/h3-7H,2H2,1H3,(H,19,21) |
| InChIKey | JACNSIOWBYQGLV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|