C11H7BrCl2N2O — CID 36679405
4-bromo-N-(2,4-dichlorophenyl)-1H-pyrrole-2-carboxamide (PubChem CID 36679405) has the molecular formula C11H7BrCl2N2O and a molecular weight of 334.00 g/mol. Its IUPAC name is 4-bromo-N-(2,4-dichlorophenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2,4-dichlorophenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 36679405 |
| Molecular Formula | C11H7BrCl2N2O |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | 4-bromo-N-(2,4-dichlorophenyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C11H7BrCl2N2O/c12-6-3-10(15-5-6)11(17)16-9-2-1-7(13)4-8(9)14/h1-5,15H,(H,16,17) |
| InChIKey | QJAAZPWUOODIAY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |