C15H18BrN3O4S — CID 134040694
4-bromo-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-1H-pyrrole-2-carboxamide (PubChem CID 134040694) has the molecular formula C15H18BrN3O4S and a molecular weight of 416.30 g/mol. Its IUPAC name is 4-bromo-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134040694 |
| Molecular Formula | C15H18BrN3O4S |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 4-bromo-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(Br)c[nH]2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C15H18BrN3O4S/c1-4-23-13-6-5-11(8-14(13)24(21,22)19(2)3)18-15(20)12-7-10(16)9-17-12/h5-9,17H,4H2,1-3H3,(H,18,20) |
| InChIKey | QKKBSICIJXLVQJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |