C19H24N2O4S — CID 26421618
N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3,5-dimethylbenzamide (PubChem CID 26421618) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3,5-dimethylbenzamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 26421618 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3,5-dimethylbenzamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(C)cc(C)c2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H24N2O4S/c1-6-25-17-8-7-16(12-18(17)26(23,24)21(4)5)20-19(22)15-10-13(2)9-14(3)11-15/h7-12H,6H2,1-5H3,(H,20,22) |
| InChIKey | UMECSBREKZFAQW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |