C20H26N4O5S — CID 25333324
4-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-methylbenzamide (PubChem CID 25333324) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 25333324 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-methylbenzamide |
| SMILES | CCOc1ccc(NCC(=O)Nc2ccc(C(=O)NC)cc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H26N4O5S/c1-5-29-17-11-10-16(12-18(17)30(27,28)24(3)4)22-13-19(25)23-15-8-6-14(7-9-15)20(26)21-2/h6-12,22H,5,13H2,1-4H3,(H,21,26)(H,23,25) |
| InChIKey | LEDVRIQHHSAQOT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|