C23H32N4O5S — CID 55565900
2-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-(2-methylpropyl)benzamide (PubChem CID 55565900) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 55565900 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetyl]amino]-N-(2-methylpropyl)benzamide |
| SMILES | CCOc1ccc(NCC(=O)Nc2ccccc2C(=O)NCC(C)C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C23H32N4O5S/c1-6-32-20-12-11-17(13-21(20)33(30,31)27(4)5)24-15-22(28)26-19-10-8-7-9-18(19)23(29)25-14-16(2)3/h7-13,16,24H,6,14-15H2,1-5H3,(H,25,29)(H,26,28) |
| InChIKey | UTPUCSRUSKDRSH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|