C16H27N3O4S — CID 119693219
(2S)-2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-methylpentanamide (PubChem CID 119693219) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119693219 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S)-2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-methylpentanamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](N)CC(C)C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H27N3O4S/c1-6-23-14-8-7-12(10-15(14)24(21,22)19(4)5)18-16(20)13(17)9-11(2)3/h7-8,10-11,13H,6,9,17H2,1-5H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | MNCKWGIHZPYECK-ZDUSSCGKSA-N |
| XLogP | 1.65 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |