C16H27N3O5S — CID 120984552
2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide (PubChem CID 120984552) has the molecular formula C16H27N3O5S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide.
| Compound Name | 2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 120984552 |
| Molecular Formula | C16H27N3O5S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide |
| SMILES | CCOc1ccc(NC(=O)C(N)COC)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C16H27N3O5S/c1-5-19(6-2)25(21,22)15-10-12(8-9-14(15)24-7-3)18-16(20)13(17)11-23-4/h8-10,13H,5-7,11,17H2,1-4H3,(H,18,20) |
| InChIKey | PQYMERJXQOXYRN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |