C22H29ClN2O5S — CID 55792391
2-(2-chloro-5-methylphenoxy)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]propanamide (PubChem CID 55792391) has the molecular formula C22H29ClN2O5S and a molecular weight of 469.00 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]propanamide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]propanamide |
|---|---|
| PubChem CID | 55792391 |
| Molecular Formula | C22H29ClN2O5S |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]propanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)Oc2cc(C)ccc2Cl)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C22H29ClN2O5S/c1-6-25(7-2)31(27,28)21-14-17(10-12-19(21)29-8-3)24-22(26)16(5)30-20-13-15(4)9-11-18(20)23/h9-14,16H,6-8H2,1-5H3,(H,24,26) |
| InChIKey | BQMVQFQTTWTQTD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |