C19H22BrFN2O5S — CID 43077928
2-(2-bromo-4-fluorophenoxy)-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]propanamide (PubChem CID 43077928) has the molecular formula C19H22BrFN2O5S and a molecular weight of 489.36 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]propanamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]propanamide |
|---|---|
| PubChem CID | 43077928 |
| Molecular Formula | C19H22BrFN2O5S |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]propanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)Oc2ccc(F)cc2Br)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H22BrFN2O5S/c1-5-27-17-9-7-14(11-18(17)29(25,26)23(3)4)22-19(24)12(2)28-16-8-6-13(21)10-15(16)20/h6-12H,5H2,1-4H3,(H,22,24) |
| InChIKey | NKOQZNIYARFOAI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |