C17H27N3O5S — CID 9470181
(2R)-2-acetamido-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methylbutanamide (PubChem CID 9470181) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methylbutanamide.
| Compound Name | (2R)-2-acetamido-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 9470181 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2R)-2-acetamido-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methylbutanamide |
| SMILES | CCOc1ccc(NC(=O)[C@H](NC(C)=O)C(C)C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H27N3O5S/c1-7-25-14-9-8-13(10-15(14)26(23,24)20(5)6)19-17(22)16(11(2)3)18-12(4)21/h8-11,16H,7H2,1-6H3,(H,18,21)(H,19,22)/t16-/m1/s1 |
| InChIKey | HWKOERNVVOKVIH-MRXNPFEDSA-N |
| XLogP | 1.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |