C25H35N3O5S — CID 55337258
N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide (PubChem CID 55337258) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 55337258 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
| SMILES | CCOc1ccc(NC(=O)C(NC(=O)Cc2ccccc2)C(C)C)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C25H35N3O5S/c1-6-28(7-2)34(31,32)22-17-20(14-15-21(22)33-8-3)26-25(30)24(18(4)5)27-23(29)16-19-12-10-9-11-13-19/h9-15,17-18,24H,6-8,16H2,1-5H3,(H,26,30)(H,27,29) |
| InChIKey | FSHYNFJLCHEVMC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |