C24H33N3O5S — CID 24640018
N-[1-[3-(diethylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide (PubChem CID 24640018) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[1-[3-(diethylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide.
| Compound Name | N-[1-[3-(diethylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 24640018 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[1-[3-(diethylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NC(C(=O)Nc1cccc(S(=O)(=O)N(CC)CC)c1)C(C)C |
| InChI | InChI=1S/C24H33N3O5S/c1-6-27(7-2)33(30,31)19-13-11-12-18(16-19)25-24(29)22(17(4)5)26-23(28)20-14-9-10-15-21(20)32-8-3/h9-17,22H,6-8H2,1-5H3,(H,25,29)(H,26,28) |
| InChIKey | MPQPNOSFHKASMP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |