C16H27N3O4S — CID 119686501
3-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]butanamide (PubChem CID 119686501) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]butanamide.
| Compound Name | 3-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]butanamide |
|---|---|
| PubChem CID | 119686501 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]butanamide |
| SMILES | CCOc1ccc(NC(=O)CC(C)N)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C16H27N3O4S/c1-5-19(6-2)24(21,22)15-11-13(8-9-14(15)23-7-3)18-16(20)10-12(4)17/h8-9,11-12H,5-7,10,17H2,1-4H3,(H,18,20) |
| InChIKey | DJDWWNUXRGGAGS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |