C19H22F2N2O4S — CID 8796668
N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3,5-difluorobenzamide (PubChem CID 8796668) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3,5-difluorobenzamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 8796668 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3,5-difluorobenzamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(F)cc(F)c2)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C19H22F2N2O4S/c1-4-23(5-2)28(25,26)18-12-16(7-8-17(18)27-6-3)22-19(24)13-9-14(20)11-15(21)10-13/h7-12H,4-6H2,1-3H3,(H,22,24) |
| InChIKey | BFKIVZUPBHXVAV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |