C20H28N2O4S2 — CID 9224063
N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-5-ethyl-4-methylthiophene-2-carboxamide (PubChem CID 9224063) has the molecular formula C20H28N2O4S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-5-ethyl-4-methylthiophene-2-carboxamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-5-ethyl-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 9224063 |
| Molecular Formula | C20H28N2O4S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-5-ethyl-4-methylthiophene-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(C)c(CC)s2)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C20H28N2O4S2/c1-6-17-14(5)12-18(27-17)20(23)21-15-10-11-16(26-9-4)19(13-15)28(24,25)22(7-2)8-3/h10-13H,6-9H2,1-5H3,(H,21,23) |
| InChIKey | IMDNNPFJZSFWFJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |