C23H32N2O6S — CID 3586249
N-[4-(diethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide (PubChem CID 3586249) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3586249 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(S(=O)(=O)N(CC)CC)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H32N2O6S/c1-6-25(7-2)32(27,28)19-13-11-18(12-14-19)24-23(26)17-15-20(29-8-3)22(31-10-5)21(16-17)30-9-4/h11-16H,6-10H2,1-5H3,(H,24,26) |
| InChIKey | FMLNELNIBOCFAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |