C21H29N3O5S2 — CID 2081481
4-(diethylsulfamoyl)-N-[4-(diethylsulfamoyl)phenyl]benzamide (PubChem CID 2081481) has the molecular formula C21H29N3O5S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[4-(diethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[4-(diethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2081481 |
| Molecular Formula | C21H29N3O5S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[4-(diethylsulfamoyl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C21H29N3O5S2/c1-5-23(6-2)30(26,27)19-13-9-17(10-14-19)21(25)22-18-11-15-20(16-12-18)31(28,29)24(7-3)8-4/h9-16H,5-8H2,1-4H3,(H,22,25) |
| InChIKey | SCCOLQJKQHRZRU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |