C21H28N2O6S — CID 2520365
N-[4-(dimethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide (PubChem CID 2520365) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 2520365 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(S(=O)(=O)N(C)C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H28N2O6S/c1-6-27-18-13-15(14-19(28-7-2)20(18)29-8-3)21(24)22-16-9-11-17(12-10-16)30(25,26)23(4)5/h9-14H,6-8H2,1-5H3,(H,22,24) |
| InChIKey | RPVKBRKUXGHVAM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |