C32H40N2O8 — CID 5007008
3,4,5-triethoxy-N-[3-[(3,4,5-triethoxybenzoyl)amino]phenyl]benzamide (PubChem CID 5007008) has the molecular formula C32H40N2O8 and a molecular weight of 580.68 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[3-[(3,4,5-triethoxybenzoyl)amino]phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[3-[(3,4,5-triethoxybenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 5007008 |
| Molecular Formula | C32H40N2O8 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 3,4,5-triethoxy-N-[3-[(3,4,5-triethoxybenzoyl)amino]phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(NC(=O)c3cc(OCC)c(OCC)c(OCC)c3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C32H40N2O8/c1-7-37-25-16-21(17-26(38-8-2)29(25)41-11-5)31(35)33-23-14-13-15-24(20-23)34-32(36)22-18-27(39-9-3)30(42-12-6)28(19-22)40-10-4/h13-20H,7-12H2,1-6H3,(H,33,35)(H,34,36) |
| InChIKey | PIPXWLUISHYQEL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |