C24H27NO6 — CID 28675140
3,4,5-triethoxy-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide (PubChem CID 28675140) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 28675140 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(-c3ccc(CO)o3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H27NO6/c1-4-28-21-13-17(14-22(29-5-2)23(21)30-6-3)24(27)25-18-9-7-8-16(12-18)20-11-10-19(15-26)31-20/h7-14,26H,4-6,15H2,1-3H3,(H,25,27) |
| InChIKey | XSUPTRWPGQRMFD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |