C22H25N3O5 — CID 108922676
N-[3-[(2-cyanoacetyl)amino]phenyl]-3,4,5-triethoxybenzamide (PubChem CID 108922676) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[3-[(2-cyanoacetyl)amino]phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[3-[(2-cyanoacetyl)amino]phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 108922676 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[3-[(2-cyanoacetyl)amino]phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(NC(=O)CC#N)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H25N3O5/c1-4-28-18-12-15(13-19(29-5-2)21(18)30-6-3)22(27)25-17-9-7-8-16(14-17)24-20(26)10-11-23/h7-9,12-14H,4-6,10H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | NKWJFXKDDZZMCW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |