C22H25N3O4 — CID 55700576
3,4,5-triethoxy-N-(3-pyrazol-1-ylphenyl)benzamide (PubChem CID 55700576) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(3-pyrazol-1-ylphenyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(3-pyrazol-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 55700576 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3,4,5-triethoxy-N-(3-pyrazol-1-ylphenyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(-n3cccn3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H25N3O4/c1-4-27-19-13-16(14-20(28-5-2)21(19)29-6-3)22(26)24-17-9-7-10-18(15-17)25-12-8-11-23-25/h7-15H,4-6H2,1-3H3,(H,24,26) |
| InChIKey | KFBMNERDVYKJEE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |