C25H26N4O4 — CID 27652156
3,4,5-triethoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide (PubChem CID 27652156) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 27652156 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3,4,5-triethoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(-c3cn4cccnc4n3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H26N4O4/c1-4-31-21-14-18(15-22(32-5-2)23(21)33-6-3)24(30)27-19-10-7-9-17(13-19)20-16-29-12-8-11-26-25(29)28-20/h7-16H,4-6H2,1-3H3,(H,27,30) |
| InChIKey | SPEMOJKZZATELW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |