C17H12N4OS — CID 122285068
N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)thiophene-3-carboxamide (PubChem CID 122285068) has the molecular formula C17H12N4OS and a molecular weight of 320.38 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)thiophene-3-carboxamide.
| Compound Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122285068 |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cn3cccnc3n2)c1)c1ccsc1 |
| InChI | InChI=1S/C17H12N4OS/c22-16(13-5-8-23-11-13)19-14-4-1-3-12(9-14)15-10-21-7-2-6-18-17(21)20-15/h1-11H,(H,19,22) |
| InChIKey | LDCSIZCOGAGYAO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |