C22H21N5O4 — CID 121033128
1-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 121033128) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 1-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 121033128 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cccc(-c3cn4cccnc4n3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N5O4/c1-29-18-11-16(12-19(30-2)20(18)31-3)25-22(28)24-15-7-4-6-14(10-15)17-13-27-9-5-8-23-21(27)26-17/h4-13H,1-3H3,(H2,24,25,28) |
| InChIKey | KMTHTZVAKCFORX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |