C20H16ClN5O2 — CID 121033104
1-(3-chloro-4-methoxyphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea (PubChem CID 121033104) has the molecular formula C20H16ClN5O2 and a molecular weight of 393.83 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea |
|---|---|
| PubChem CID | 121033104 |
| Molecular Formula | C20H16ClN5O2 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc(-c3cn4cccnc4n3)c2)cc1Cl |
| InChI | InChI=1S/C20H16ClN5O2/c1-28-18-7-6-15(11-16(18)21)24-20(27)23-14-5-2-4-13(10-14)17-12-26-9-3-8-22-19(26)25-17/h2-12H,1H3,(H2,23,24,27) |
| InChIKey | POKZIPOINVCTLZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |