C19H13F2N5O — CID 122285057
1-(3,4-difluorophenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea (PubChem CID 122285057) has the molecular formula C19H13F2N5O and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea |
|---|---|
| PubChem CID | 122285057 |
| Molecular Formula | C19H13F2N5O |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea |
| SMILES | O=C(Nc1cccc(-c2cn3cccnc3n2)c1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H13F2N5O/c20-15-6-5-14(10-16(15)21)24-19(27)23-13-4-1-3-12(9-13)17-11-26-8-2-7-22-18(26)25-17/h1-11H,(H2,23,24,27) |
| InChIKey | SQTWSCLSAFPQHT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |