C21H19N5O — CID 121033112
1-(2-ethylphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea (PubChem CID 121033112) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea.
| Compound Name | 1-(2-ethylphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea |
|---|---|
| PubChem CID | 121033112 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-(2-ethylphenyl)-3-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)Nc1cccc(-c2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C21H19N5O/c1-2-15-7-3-4-10-18(15)25-21(27)23-17-9-5-8-16(13-17)19-14-26-12-6-11-22-20(26)24-19/h3-14H,2H2,1H3,(H2,23,25,27) |
| InChIKey | MXVHHGQRHQOCKR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |