C23H22N4O2 — CID 7080161
4-butoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide (PubChem CID 7080161) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-butoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide.
| Compound Name | 4-butoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 7080161 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-butoxy-N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cccc(-c3cn4cccnc4n3)c2)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-2-3-14-29-20-10-8-17(9-11-20)22(28)25-19-7-4-6-18(15-19)21-16-27-13-5-12-24-23(27)26-21/h4-13,15-16H,2-3,14H2,1H3,(H,25,28) |
| InChIKey | GHINCFXHWXWFOQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|